CAS 2377606-03-4 appears in our catalog under these names: (3-{[(tert-butoxy)carbonyl]amino}-5-chlorophenyl)boronic acid, 98%, (3-{((tert-butoxy)carbonyl)amino}-5-chlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[3-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2377606-03-4) is a chemical compound with the molecular formula C11H15BClNO4 and a molecular weight of 271.51 g/mol. IUPAC name: [3-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: YYIDKPOOUZOBBR-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO4 |
|---|---|
| Molecular weight | 271.51 g/mol |
| IUPAC name | [3-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | YYIDKPOOUZOBBR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)