cas: 1704069-72-6 — see every product listed under this CAS number, including other names
(3-((tert-Butoxycarbonyl)amino)-4-fluorophenyl)boronic acid 98% (CAS 1704069-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A775764-1g |
| cas | 1704069-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A775764 |
[4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1704069-72-6) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: PPCCJWGXGNNJOM-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | PPCCJWGXGNNJOM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)