CAS 2246573-76-0 appears in our catalog under these names: (3-{[(tert-Butoxy)carbonyl]amino}-2-fluorophenyl)boronic acid, 98%, (3-((tert-Butoxycarbonyl)amino)-2-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2246573-76-0) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: UOKSNKVNRPSQNZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | UOKSNKVNRPSQNZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)NC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)