cas: 900152-53-6 — see every product listed under this CAS number, including other names
(3-((tert-Butyldimethylsilyl)oxy)-4-methoxyphenyl)boronic acid, 98% (CAS 900152-53-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621248-1G |
| cas | 900152-53-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 5g | 2845.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid (CAS 900152-53-6) is a chemical compound with the molecular formula C13H23BO4Si and a molecular weight of 282.22 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid. InChIKey: YENCFJOVWUOWKV-UHFFFAOYSA-N.
| Molecular formula | C13H23BO4Si |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid |
| InChIKey | YENCFJOVWUOWKV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)