CAS 900152-53-6 appears in our catalog under these names: 3-(t-Butyldimethylsilyloxy)-4-methoxyphenylboronic acid, 98%, 3-(t-Butyldimethylsilyloxy)-4-methoxyphenylboronic acid 98%, 3-(t-Butyldimethylsilyloxy)-4-methoxyphenylboronic acid, 98%, 98%, (3-((tert-Butyldimethylsilyl)oxy)-4-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid (CAS 900152-53-6) is a chemical compound with the molecular formula C13H23BO4Si and a molecular weight of 282.22 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid. InChIKey: YENCFJOVWUOWKV-UHFFFAOYSA-N.
| Molecular formula | C13H23BO4Si |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]boronic acid |
| InChIKey | YENCFJOVWUOWKV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)