(3-((tert-Butyldimethylsilyl)oxy)-5-(methoxycarbonyl)phenyl)boronic acid, 95%
cas: 1416251-98-3 — see every product listed under this CAS number, including other names
(3-((tert-Butyldimethylsilyl)oxy)-5-(methoxycarbonyl)phenyl)boronic acid, 95% (CAS 1416251-98-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1677304-250mg |
| cas | 1416251-98-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 965.56 Pln | |
| Ambeed | 5g | 3329.62 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 822.80 Pln | |
| Chemat | 5g | 2790.80 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1036.33 Pln | |
| BLDpharm | 5g | 3585.43 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid (CAS 1416251-98-3) is a chemical compound with the molecular formula C14H23BO5Si and a molecular weight of 310.23 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid. InChIKey: WVEROKKPZZNURS-UHFFFAOYSA-N.
| Molecular formula | C14H23BO5Si |
|---|---|
| Molecular weight | 310.23 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid |
| InChIKey | WVEROKKPZZNURS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)O[Si](C)(C)C(C)(C)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)