CAS 1416251-98-3 appears in our catalog under these names: (3-((tert-Butyldimethylsilyl)oxy)-5-(methoxycarbonyl)phenyl)boronic acid, 95%, 95%, (3-((tert-Butyldimethylsilyl)oxy)-5-(methoxycarbonyl)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
[3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid (CAS 1416251-98-3) is a chemical compound with the molecular formula C14H23BO5Si and a molecular weight of 310.23 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid. InChIKey: WVEROKKPZZNURS-UHFFFAOYSA-N.
| Molecular formula | C14H23BO5Si |
|---|---|
| Molecular weight | 310.23 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonylphenyl]boronic acid |
| InChIKey | WVEROKKPZZNURS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)O[Si](C)(C)C(C)(C)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)