(3-(3-(4-Chlorophenyl)ureido)phenyl)boronic acid, 95%
cas: 842149-00-2 — see every product listed under this CAS number, including other names
(3-(3-(4-Chlorophenyl)ureido)phenyl)boronic acid, 95% (CAS 842149-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1676805-100mg |
| cas | 842149-00-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 475.41 Pln | |
| BLDpharm | 1g | 1130.74 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid (CAS 842149-00-2) is a chemical compound with the molecular formula C13H12BClN2O3 and a molecular weight of 290.51 g/mol. IUPAC name: [3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid. InChIKey: PRLAHSCAMFRECS-UHFFFAOYSA-N.
| Molecular formula | C13H12BClN2O3 |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | [3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid |
| InChIKey | PRLAHSCAMFRECS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)