CAS 842149-00-2 appears in our catalog under these names: (3-(3-(4-Chlorophenyl)ureido)phenyl)boronic acid, 95%, 95%, (3-(3-(4-Chlorophenyl)ureido)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid (CAS 842149-00-2) is a chemical compound with the molecular formula C13H12BClN2O3 and a molecular weight of 290.51 g/mol. IUPAC name: [3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid. InChIKey: PRLAHSCAMFRECS-UHFFFAOYSA-N.
| Molecular formula | C13H12BClN2O3 |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | [3-[(4-chlorophenyl)carbamoylamino]phenyl]boronic acid |
| InChIKey | PRLAHSCAMFRECS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)