cas: 2055662-25-2 — see every product listed under this CAS number, including other names
(3-(Cyclopropylthio)phenyl)boronic acid 97% (CAS 2055662-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243538-100mg |
| cas | 2055662-25-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 681.88 Pln | |
| Ambeed | 1g | 1366.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A243538 |
(3-cyclopropylsulfanylphenyl)boronic acid (CAS 2055662-25-2) is a chemical compound with the molecular formula C9H11BO2S and a molecular weight of 194.06 g/mol. IUPAC name: (3-cyclopropylsulfanylphenyl)boronic acid. InChIKey: IRIBESPMJRRSQT-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2S |
|---|---|
| Molecular weight | 194.06 g/mol |
| IUPAC name | (3-cyclopropylsulfanylphenyl)boronic acid |
| InChIKey | IRIBESPMJRRSQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)SC2CC2)(O)O |
Computed by PubChem (NCBI)