CAS 411229-80-6 appears in our catalog under these names: 4-Cyclopropylthiophenylboronic acid, 96%, (4-(Cyclopropylthio)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(4-cyclopropylsulfanylphenyl)boronic acid (CAS 411229-80-6) is a chemical compound with the molecular formula C9H11BO2S and a molecular weight of 194.06 g/mol. IUPAC name: (4-cyclopropylsulfanylphenyl)boronic acid. InChIKey: APWUGUMSANWOII-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2S |
|---|---|
| Molecular weight | 194.06 g/mol |
| IUPAC name | (4-cyclopropylsulfanylphenyl)boronic acid |
| InChIKey | APWUGUMSANWOII-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC2CC2)(O)O |
Computed by PubChem (NCBI)