cas: 871333-07-2 — see every product listed under this CAS number, including other names
(3-(Ethyl(methyl)carbamoyl)phenyl)boronic acid 98% (CAS 871333-07-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A839718-250mg |
| cas | 871333-07-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln | |
| Ambeed | 25g | 5098.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A839718 |
[3-[ethyl(methyl)carbamoyl]phenyl]boronic acid (CAS 871333-07-2) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [3-[ethyl(methyl)carbamoyl]phenyl]boronic acid. InChIKey: WVUBMQPFOZJFAA-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [3-[ethyl(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | WVUBMQPFOZJFAA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(C)CC)(O)O |
Computed by PubChem (NCBI)