CAS 212780-23-9 appears in our catalog under these names: (3-Butanamidophenyl)boronic acid, 95%, (3–butanamidophenyl)boronic acid, (3-Butyramidophenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[3-(butanoylamino)phenyl]boronic acid (CAS 212780-23-9) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [3-(butanoylamino)phenyl]boronic acid. InChIKey: WKBFEWURUDLFFY-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [3-(butanoylamino)phenyl]boronic acid |
| InChIKey | WKBFEWURUDLFFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)CCC)(O)O |
Computed by PubChem (NCBI)