cas: 723282-09-5 — see every product listed under this CAS number, including other names
(3-(Isobutylcarbamoyl)phenyl)boronic acid, ≥97%, ≥97% (CAS 723282-09-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F0WU-5g |
| cas | 723282-09-5 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1874.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
[3-(2-methylpropylcarbamoyl)phenyl]boronic acid (CAS 723282-09-5) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [3-(2-methylpropylcarbamoyl)phenyl]boronic acid. InChIKey: VRCFUCPIPJUGKG-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [3-(2-methylpropylcarbamoyl)phenyl]boronic acid |
| InChIKey | VRCFUCPIPJUGKG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCC(C)C)(O)O |
Computed by PubChem (NCBI)