Products 146140-95-6

CAS 146140-95-6 appears in our catalog under these names: (2-Pivalamidophenyl)boronic acid, 95%, 2-(tert-Butylcarbonylamino)phenylboronic acid, 96%, 2–(Pivalamido)phenylboronic Acid, 2-(Pivalamido)phenylboronic Acid (contains varying amounts of Anhydride), (2-Pivalamidophenyl)boronic acid 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

[2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 146140-95-6) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: MXRAJVMTCAUABO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16BNO3
Molecular weight221.06 g/mol
IUPAC name[2-(2,2-dimethylpropanoylamino)phenyl]boronic acid
InChIKeyMXRAJVMTCAUABO-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1NC(=O)C(C)(C)C)(O)O

Computed by PubChem (NCBI)