CAS 146140-95-6 appears in our catalog under these names: (2-Pivalamidophenyl)boronic acid, 95%, 2-(tert-Butylcarbonylamino)phenylboronic acid, 96%, 2–(Pivalamido)phenylboronic Acid, 2-(Pivalamido)phenylboronic Acid (contains varying amounts of Anhydride), (2-Pivalamidophenyl)boronic acid 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
[2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 146140-95-6) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: MXRAJVMTCAUABO-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | MXRAJVMTCAUABO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)