(3-(tert-Butoxy)-2',6'-diisopropyl-6-methoxy-[1,1'-biphenyl]-2-yl)dicyclohexylphosphane, 98%
cas: 2489243-29-8 — see every product listed under this CAS number, including other names
(3-(tert-Butoxy)-2',6'-diisopropyl-6-methoxy-[1,1'-biphenyl]-2-yl)dicyclohexylphosphane, 98% (CAS 2489243-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD01302798-100mg |
| cas | 2489243-29-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 936.36 Pln | |
| BLDpharm | 250mg | 1536.15 Pln | |
| BLDpharm | 1g | 4029.72 Pln | |
| BLDpharm | 5g | 13892.91 Pln | |
| BLDpharm | 10g | 22189.99 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 4058.00 Pln | |
| Chemat | 10g | 6472.40 Pln | |
| Fluorochem | 5g | 8198.17 Pln | |
| Fluorochem | 100mg | 653.95 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2705.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Dicyclohexyl-[2-[2,6-di(propan-2-yl)phenyl]-3-methoxy-6-[(2-methylpropan-2-yl)oxy]phenyl]phosphane (CAS 2489243-29-8) is a chemical compound with the molecular formula C35H53O2P and a molecular weight of 536.8 g/mol. IUPAC name: dicyclohexyl-[2-[2,6-di(propan-2-yl)phenyl]-3-methoxy-6-[(2-methylpropan-2-yl)oxy]phenyl]phosphane. InChIKey: JKLUIDIKASJZCK-UHFFFAOYSA-N.
| Molecular formula | C35H53O2P |
|---|---|
| Molecular weight | 536.8 g/mol |
| IUPAC name | dicyclohexyl-[2-[2,6-di(propan-2-yl)phenyl]-3-methoxy-6-[(2-methylpropan-2-yl)oxy]phenyl]phosphane |
| InChIKey | JKLUIDIKASJZCK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)C2=C(C=CC(=C2P(C3CCCCC3)C4CCCCC4)OC(C)(C)C)OC |
Computed by PubChem (NCBI)
Synonyms:
GPHOS