cas: 2377609-82-8 — see every product listed under this CAS number, including other names
(3-{[(Benzyloxy)carbonyl]amino}-4,5-difluorophenyl)boronic acid, 98%, 98% (CAS 2377609-82-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRRK-250mg |
| cas | 2377609-82-8 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 314.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid (CAS 2377609-82-8) is a chemical compound with the molecular formula C14H12BF2NO4 and a molecular weight of 307.06 g/mol. IUPAC name: [3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid. InChIKey: WPJPJGBXFZDYNR-UHFFFAOYSA-N.
| Molecular formula | C14H12BF2NO4 |
|---|---|
| Molecular weight | 307.06 g/mol |
| IUPAC name | [3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid |
| InChIKey | WPJPJGBXFZDYNR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)NC(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)