CAS 2377609-82-8 appears in our catalog under these names: (3-{[(Benzyloxy)carbonyl]amino}-4,5-difluorophenyl)boronic acid, 96%, (3-(((Benzyloxy)carbonyl)amino)-4,5-difluorophenyl)boronic acid 98%, (3-{[(Benzyloxy)carbonyl]amino}-4,5-difluorophenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid (CAS 2377609-82-8) is a chemical compound with the molecular formula C14H12BF2NO4 and a molecular weight of 307.06 g/mol. IUPAC name: [3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid. InChIKey: WPJPJGBXFZDYNR-UHFFFAOYSA-N.
| Molecular formula | C14H12BF2NO4 |
|---|---|
| Molecular weight | 307.06 g/mol |
| IUPAC name | [3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid |
| InChIKey | WPJPJGBXFZDYNR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)NC(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)