(3-Amino-4-methoxyphenyl)boronic acid 96%
cas: 879893-98-8 — see every product listed under this CAS number, including other names
(3-Amino-4-methoxyphenyl)boronic acid 96% (CAS 879893-98-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A853020-50mg |
| cas | 879893-98-8 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 409.31 Pln | |
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1110.19 Pln | |
| Ambeed | 1g | 2717.75 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A853020 |
(3-amino-4-methoxyphenyl)boronic acid (CAS 879893-98-8) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 166.97 g/mol. IUPAC name: (3-amino-4-methoxyphenyl)boronic acid. InChIKey: QMYCMNKKHXJWLC-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 166.97 g/mol |
| IUPAC name | (3-amino-4-methoxyphenyl)boronic acid |
| InChIKey | QMYCMNKKHXJWLC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)N)(O)O |
Computed by PubChem (NCBI)