CAS 879893-98-8 appears in our catalog under these names: 3-Amino-4-methoxyphenylboronic acid, 96%, (3-Amino-4-methoxyphenyl)boronic acid 96%, 3-Amino-4-methoxyphenylboronic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg.
(3-amino-4-methoxyphenyl)boronic acid (CAS 879893-98-8) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 166.97 g/mol. IUPAC name: (3-amino-4-methoxyphenyl)boronic acid. InChIKey: QMYCMNKKHXJWLC-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 166.97 g/mol |
| IUPAC name | (3-amino-4-methoxyphenyl)boronic acid |
| InChIKey | QMYCMNKKHXJWLC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)N)(O)O |
Computed by PubChem (NCBI)