cas: 89996-01-0 — see every product listed under this CAS number, including other names
(3-Aminopropyl)triphenylphosphonium bromide 95% (CAS 89996-01-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1228051-50mg |
| cas | 89996-01-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 370.38 Pln | |
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1660.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1228051 |
3-aminopropyl(triphenyl)phosphanium bromide (CAS 89996-01-0) is a chemical compound with the molecular formula C21H23BrNP and a molecular weight of 400.3 g/mol. IUPAC name: 3-aminopropyl(triphenyl)phosphanium bromide. InChIKey: UPYKKMDXNPTXPZ-UHFFFAOYSA-M.
| Molecular formula | C21H23BrNP |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 3-aminopropyl(triphenyl)phosphanium bromide |
| InChIKey | UPYKKMDXNPTXPZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCN)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)