cas: 870778-83-9 — see every product listed under this CAS number, including other names
(3-Bromo-2-((3-chlorobenzyl)oxy)-5-methylphenyl)boronic acid 98% (CAS 870778-83-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A496556-250mg |
| cas | 870778-83-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2094.75 Pln | |
| Ambeed | 10g | 3746.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A496556 |
[3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 870778-83-9) is a chemical compound with the molecular formula C14H13BBrClO3 and a molecular weight of 355.42 g/mol. IUPAC name: [3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: GKYZLQGDWVHPPQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BBrClO3 |
|---|---|
| Molecular weight | 355.42 g/mol |
| IUPAC name | [3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | GKYZLQGDWVHPPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC(=CC=C2)Cl)Br)C)(O)O |
Computed by PubChem (NCBI)