CAS 870778-83-9 appears in our catalog under these names: 3-Bromo-2-(3'-chlorobenzyloxy)-5-methylphenylboronic acid, 95%, (3-Bromo-2-((3-chlorobenzyl)oxy)-5-methylphenyl)boronic acid 98%, (3-Bromo-2-((3-chlorobenzyl)oxy)-5-methylphenyl)boronic acid, 98%, 98%, (3-Bromo-2-((3-chlorobenzyl)oxy)-5-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
[3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 870778-83-9) is a chemical compound with the molecular formula C14H13BBrClO3 and a molecular weight of 355.42 g/mol. IUPAC name: [3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: GKYZLQGDWVHPPQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BBrClO3 |
|---|---|
| Molecular weight | 355.42 g/mol |
| IUPAC name | [3-bromo-2-[(3-chlorophenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | GKYZLQGDWVHPPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC(=CC=C2)Cl)Br)C)(O)O |
Computed by PubChem (NCBI)