cas: 913835-88-8 — see every product listed under this CAS number, including other names
(3-Bromo-5-(ethoxycarbonyl)phenyl)boronic acid, 98% (CAS 913835-88-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A480014-250mg |
| cas | 913835-88-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 349.93 Pln | |
| AmBeed | 25g | 3116.68 Pln | |
| Fluorochem | 1g | 357.18 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-bromo-5-ethoxycarbonylphenyl)boronic acid (CAS 913835-88-8) is a chemical compound with the molecular formula C9H10BBrO4 and a molecular weight of 272.89 g/mol. IUPAC name: (3-bromo-5-ethoxycarbonylphenyl)boronic acid. InChIKey: KNUQTRXBSGKILE-UHFFFAOYSA-N.
| Molecular formula | C9H10BBrO4 |
|---|---|
| Molecular weight | 272.89 g/mol |
| IUPAC name | (3-bromo-5-ethoxycarbonylphenyl)boronic acid |
| InChIKey | KNUQTRXBSGKILE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)