Ethyl 3-borono-5-bromobenzoate, 98%, 98%
cas: 913835-88-8 — see every product listed under this CAS number, including other names
Ethyl 3-borono-5-bromobenzoate, 98%, 98% (CAS 913835-88-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117BHQ-250mg |
| cas | 913835-88-8 |
| size | 250mg |
| availability | 40g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 10g | 981.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-5-ethoxycarbonylphenyl)boronic acid (CAS 913835-88-8) is a chemical compound with the molecular formula C9H10BBrO4 and a molecular weight of 272.89 g/mol. IUPAC name: (3-bromo-5-ethoxycarbonylphenyl)boronic acid. InChIKey: KNUQTRXBSGKILE-UHFFFAOYSA-N.
| Molecular formula | C9H10BBrO4 |
|---|---|
| Molecular weight | 272.89 g/mol |
| IUPAC name | (3-bromo-5-ethoxycarbonylphenyl)boronic acid |
| InChIKey | KNUQTRXBSGKILE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Bromo-5-(ethoxycarbonyl)phenyl)boronic acid, Ethyl 3-borono-5-bromobenzoate, 3-bromo-5-(ethoxycarbonyl)phenylboronic acid, 3-Bromo-5-(ethoxycarbonyl)benzeneboronic acid, (3-bromo-5-ethoxycarbonylphenyl)boronic acid, [3-Bromo-5-(ethoxycarbonyl)phenyl]boronic acid, C9H10BBrO4, (3-Bromo-5-(ethoxycarbonyl)phenyl)boronicacid, (3-bromo-5-ethoxycarbonyl-phenyl)boronic acid