cas: 913835-64-0 — see every product listed under this CAS number, including other names
(3-Bromo-5-(trifluoromethyl)phenyl)boronic acid 98% (CAS 913835-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A593501-250mg |
| cas | 913835-64-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 982.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A593501 |
[3-bromo-5-(trifluoromethyl)phenyl]boronic acid (CAS 913835-64-0) is a chemical compound with the molecular formula C7H5BBrF3O2 and a molecular weight of 268.83 g/mol. IUPAC name: [3-bromo-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: VBYUDGIATDPECY-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O2 |
|---|---|
| Molecular weight | 268.83 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | VBYUDGIATDPECY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)