CAS 1451393-48-8 appears in our catalog under these names: 2-Bromo-3-trifluoromethylphenylboronic acid, 95%, (2-Bromo-3-(trifluoromethyl)phenyl)boronic acid, 95%, (2-Bromo-3-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
[2-bromo-3-(trifluoromethyl)phenyl]boronic acid (CAS 1451393-48-8) is a chemical compound with the molecular formula C7H5BBrF3O2 and a molecular weight of 268.83 g/mol. IUPAC name: [2-bromo-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: DGEDEAVZOHLRDU-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O2 |
|---|---|
| Molecular weight | 268.83 g/mol |
| IUPAC name | [2-bromo-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DGEDEAVZOHLRDU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)