cas: 2096341-66-9 — see every product listed under this CAS number, including other names
(3-Bromo-5-hydroxyphenyl)boronic acid 98% (CAS 2096341-66-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379112-100mg |
| cas | 2096341-66-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 932.19 Pln | |
| Ambeed | 5g | 2834.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1379112 |
(3-bromo-5-hydroxyphenyl)boronic acid (CAS 2096341-66-9) is a chemical compound with the molecular formula C6H6BBrO3 and a molecular weight of 216.83 g/mol. IUPAC name: (3-bromo-5-hydroxyphenyl)boronic acid. InChIKey: VBZFFUITZWZGEE-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3 |
|---|---|
| Molecular weight | 216.83 g/mol |
| IUPAC name | (3-bromo-5-hydroxyphenyl)boronic acid |
| InChIKey | VBZFFUITZWZGEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)O)(O)O |
Computed by PubChem (NCBI)