CAS 1701448-16-9 appears in our catalog under these names: 4-bromo-3-hydroxyphenylboronic acid, 95%, 4-Bromo-3-hydroxyphenylboronic Acid, (4-Bromo-3-hydroxyphenyl)boronic acid, 98+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(4-bromo-3-hydroxyphenyl)boronic acid (CAS 1701448-16-9) is a chemical compound with the molecular formula C6H6BBrO3 and a molecular weight of 216.83 g/mol. IUPAC name: (4-bromo-3-hydroxyphenyl)boronic acid. InChIKey: CJZSBTMJFVLOFA-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3 |
|---|---|
| Molecular weight | 216.83 g/mol |
| IUPAC name | (4-bromo-3-hydroxyphenyl)boronic acid |
| InChIKey | CJZSBTMJFVLOFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)O)(O)O |
Computed by PubChem (NCBI)