cas: 1451390-87-6 — see every product listed under this CAS number, including other names
(3-Bromo-5-isopropylphenyl)boronic acid, 97% (CAS 1451390-87-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694057-1G |
| cas | 1451390-87-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 10g | 1736.91 Pln | |
| Fluorochem | 25g | 4267.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3-bromo-5-propan-2-ylphenyl)boronic acid (CAS 1451390-87-6) is a chemical compound with the molecular formula C9H12BBrO2 and a molecular weight of 242.91 g/mol. IUPAC name: (3-bromo-5-propan-2-ylphenyl)boronic acid. InChIKey: DNQVEISBEIMQOG-UHFFFAOYSA-N.
| Molecular formula | C9H12BBrO2 |
|---|---|
| Molecular weight | 242.91 g/mol |
| IUPAC name | (3-bromo-5-propan-2-ylphenyl)boronic acid |
| InChIKey | DNQVEISBEIMQOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(C)C)(O)O |
Computed by PubChem (NCBI)