CAS 2096338-86-0 appears in our catalog under these names: 2-BROMO-4-ISOPROPYLPHENYLBORONIC ACID, 97%, 97%, 2-Bromo-4-isopropylphenylboronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-4-propan-2-ylphenyl)boronic acid (CAS 2096338-86-0) is a chemical compound with the molecular formula C9H12BBrO2 and a molecular weight of 242.91 g/mol. IUPAC name: (2-bromo-4-propan-2-ylphenyl)boronic acid. InChIKey: YEHIZUUXYLXRNS-UHFFFAOYSA-N.
| Molecular formula | C9H12BBrO2 |
|---|---|
| Molecular weight | 242.91 g/mol |
| IUPAC name | (2-bromo-4-propan-2-ylphenyl)boronic acid |
| InChIKey | YEHIZUUXYLXRNS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(C)C)Br)(O)O |
Computed by PubChem (NCBI)