(3-Butyramidophenyl)boronic acid, 95%, 95%
cas: 212780-23-9 — see every product listed under this CAS number, including other names
(3-Butyramidophenyl)boronic acid, 95%, 95% (CAS 212780-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11S4PG-250mg |
| cas | 212780-23-9 |
| size | 250mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 1782.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-(butanoylamino)phenyl]boronic acid (CAS 212780-23-9) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [3-(butanoylamino)phenyl]boronic acid. InChIKey: WKBFEWURUDLFFY-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [3-(butanoylamino)phenyl]boronic acid |
| InChIKey | WKBFEWURUDLFFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)CCC)(O)O |
Computed by PubChem (NCBI)