cas: 877383-14-7 — see every product listed under this CAS number, including other names
(3-Chloro-4-(methylthio)phenyl)boronic acid 98+% (CAS 877383-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A330305-100mg |
| cas | 877383-14-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 3557.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A330305 |
(3-chloro-4-methylsulfanylphenyl)boronic acid (CAS 877383-14-7) is a chemical compound with the molecular formula C7H8BClO2S and a molecular weight of 202.47 g/mol. IUPAC name: (3-chloro-4-methylsulfanylphenyl)boronic acid. InChIKey: XHRBBKXFCXFGTQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO2S |
|---|---|
| Molecular weight | 202.47 g/mol |
| IUPAC name | (3-chloro-4-methylsulfanylphenyl)boronic acid |
| InChIKey | XHRBBKXFCXFGTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)Cl)(O)O |
Computed by PubChem (NCBI)