CAS 1451392-52-1 appears in our catalog under these names: 5-Chloro-3-(meththio)phenylboronic acid, 95%, 5-Chloro-3-(meththio)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(3-chloro-5-methylsulfanylphenyl)boronic acid (CAS 1451392-52-1) is a chemical compound with the molecular formula C7H8BClO2S and a molecular weight of 202.47 g/mol. IUPAC name: (3-chloro-5-methylsulfanylphenyl)boronic acid. InChIKey: GQYXPJXCFHHTIF-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO2S |
|---|---|
| Molecular weight | 202.47 g/mol |
| IUPAC name | (3-chloro-5-methylsulfanylphenyl)boronic acid |
| InChIKey | GQYXPJXCFHHTIF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)SC)(O)O |
Computed by PubChem (NCBI)