cas: 1310048-95-3 — see every product listed under this CAS number, including other names
(3-Fluorobenzyl)boronic acid pinacol ester, 97% (CAS 1310048-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469060-100MG |
| cas | 1310048-95-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 3986.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310048-95-3) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LIQLVQAWDJTUIM-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LIQLVQAWDJTUIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)