cas: 622864-48-6 — see every product listed under this CAS number, including other names
(3-Hydroxy-4-methoxyphenyl)boronic acid 98% (CAS 622864-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358607-100mg |
| cas | 622864-48-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2061.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A358607 |
(3-hydroxy-4-methoxyphenyl)boronic acid (CAS 622864-48-6) is a chemical compound with the molecular formula C7H9BO4 and a molecular weight of 167.96 g/mol. IUPAC name: (3-hydroxy-4-methoxyphenyl)boronic acid. InChIKey: YOPHDOOHKDJUAM-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (3-hydroxy-4-methoxyphenyl)boronic acid |
| InChIKey | YOPHDOOHKDJUAM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)O)(O)O |
Computed by PubChem (NCBI)