cas: 871332-81-9 — see every product listed under this CAS number, including other names
(3-Nitro-5-(pyrrolidine-1-carbonyl)phenyl)boronic acid 98% (CAS 871332-81-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A468418-250mg |
| cas | 871332-81-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A468418 |
[3-nitro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid (CAS 871332-81-9) is a chemical compound with the molecular formula C11H13BN2O5 and a molecular weight of 264.04 g/mol. IUPAC name: [3-nitro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid. InChIKey: DAQRBZSNRHKVIM-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O5 |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | [3-nitro-5-(pyrrolidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | DAQRBZSNRHKVIM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)