CAS 1356823-20-5 is the registry number for 2-Methoxy-3-pyridinylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2-methoxy-3-pyridinyl)-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (CAS 1356823-20-5) is a chemical compound with the molecular formula C11H13BN2O5 and a molecular weight of 264.04 g/mol. IUPAC name: 1-(2-methoxy-3-pyridinyl)-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione. InChIKey: BZDUXFKYSALIDL-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O5 |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | 1-(2-methoxy-3-pyridinyl)-5-methyl-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| InChIKey | BZDUXFKYSALIDL-UHFFFAOYSA-N |
| SMILES | [B-]12([N+](CC(=O)O1)(CC(=O)O2)C)C3=C(N=CC=C3)OC |
Computed by PubChem (NCBI)