cas: 871329-60-1 — see every product listed under this CAS number, including other names
(3-morpholin-4-ylsulfonylphenyl)boronic acid, 95%, 95% (CAS 871329-60-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147EU-250mg |
| cas | 871329-60-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 602.00 Pln | |
| Chemat | 5g | 2186.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 871329-60-1) is a chemical compound with the molecular formula C10H14BNO5S and a molecular weight of 271.10 g/mol. IUPAC name: (3-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: HIKVVOUXXNJGAK-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO5S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | (3-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | HIKVVOUXXNJGAK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)