CAS 957062-65-6 appears in our catalog under these names: 2-(Morpholinosulfonyl)phenylboronic acid, 98%, 2–(Morpholinosulfonyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
(2-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 957062-65-6) is a chemical compound with the molecular formula C10H14BNO5S and a molecular weight of 271.10 g/mol. IUPAC name: (2-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: BZFBAPLYGJEVGH-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO5S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | (2-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | BZFBAPLYGJEVGH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)