cas: 592533-90-9 — see every product listed under this CAS number, including other names
(3AS,4R,6S,6AR)-6-AMINO-2,2-DIMETHYL-HEXAHYDROCYCLOPENTA[D][1,3]DIOXOL-4-OL, 95% (CAS 592533-90-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504147-100MG |
| cas | 592533-90-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1049.65 Pln | |
| Fluorochem | 250mg | 1643.19 Pln | |
| Fluorochem | 1g | 3439.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3aS,4R,6S,6aR)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (CAS 592533-90-9) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: (3aS,4R,6S,6aR)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol. InChIKey: AXPYGRDXRLICKY-WNJXEPBRSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (3aS,4R,6S,6aR)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| InChIKey | AXPYGRDXRLICKY-WNJXEPBRSA-N |
| SMILES | CC1(O[C@@H]2[C@H](C[C@H]([C@@H]2O1)O)N)C |
Computed by PubChem (NCBI)