Products 1382774-58-4

CAS 1382774-58-4 is the registry number for 2-Methylpiperidin-4-one, acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.

Structural formula: {0} (CAS {1})

Acetic acid;2-methylpiperidin-4-one (CAS 1382774-58-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: acetic acid;2-methylpiperidin-4-one. InChIKey: PNNYMZXLAXMKNO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC nameacetic acid;2-methylpiperidin-4-one
InChIKeyPNNYMZXLAXMKNO-UHFFFAOYSA-N
SMILESCC1CC(=O)CCN1.CC(=O)O

Computed by PubChem (NCBI)