cas: 141043-16-5 — see every product listed under this CAS number, including other names
(3R)-(+)-3-(Trifluoroacetamido)pyrrolidine Hydrochloride, >98.0%(T) (CAS 141043-16-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1369-1G |
| cas | 141043-16-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 206.86 Pln | |
| TCI | 25g | 2213.09 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2,2,2-trifluoro-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride (CAS 141043-16-5) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride. InChIKey: CMZSIQCZAFAEDH-PGMHMLKASA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride |
| InChIKey | CMZSIQCZAFAEDH-PGMHMLKASA-N |
| SMILES | C1CNC[C@@H]1NC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)