CAS 245487-45-0 appears in our catalog under these names: 2,2,2-Trifluoro-1-(piperazin-1-yl)ethanone hydrochloride, 95%, 2,2,2–Trifluoro–1–(Piperazin–1–Yl)Ethanone Hydrochloride, 2,2,2-Trifluoro-1-(Piperazin-1-Yl)Ethanone Hydrochloride, 2,2,2-Trifluoro-1-(piperazin-1-yl)ethanonehydrochloride 95%, 2,2,2-Trifluoro-1-(piperazin-1-yl)ethanonehydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 500mg, 2.5g.
2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride (CAS 245487-45-0) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride. InChIKey: JLIKRYCMRPFILF-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | JLIKRYCMRPFILF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)