cas: 486460-00-8 — see every product listed under this CAS number, including other names
(3R)-3-[(1,1-Dimethylethoxycarbonyl)amino]-4-(2,4,5-trifluorophenyl)butanoic acid, 98%, 98% (CAS 486460-00-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149OZ-1g |
| cas | 486460-00-8 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 198.80 Pln | |
| Chemat | 500g | 806.40 Pln | |
| Chemat | 1kg | 1283.60 Pln | |
| Chemat | 50g | 136.40 Pln | |
| Chemat | 250g | 405.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoic acid (CAS 486460-00-8) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoic acid. InChIKey: TUAXCHGULMWHIO-SECBINFHSA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoic acid |
| InChIKey | TUAXCHGULMWHIO-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1F)F)F)CC(=O)O |
Computed by PubChem (NCBI)