CAS 203640-52-2 is the registry number for Z-Val-otfa, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
2,2,2-trifluoroethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (CAS 203640-52-2) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: 2,2,2-trifluoroethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: MGBJQOMWGYZJTQ-LBPRGKRZSA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | MGBJQOMWGYZJTQ-LBPRGKRZSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC(F)(F)F)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)