cas: 1523530-38-2 — see every product listed under this CAS number, including other names
(3R,4R)-4-AMINOTETRAHYDRO-2H-PYRAN-3-OL HCL, 97% (CAS 1523530-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467926-100MG |
| cas | 1523530-38-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 263.47 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1440.14 Pln | |
| Fluorochem | 10g | 2674.08 Pln | |
| Fluorochem | 25g | 5027.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4R)-4-aminooxan-3-ol;hydrochloride (CAS 1523530-38-2) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (3R,4R)-4-aminooxan-3-ol;hydrochloride. InChIKey: GZXXMEFWSWRREY-JBUOLDKXSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (3R,4R)-4-aminooxan-3-ol;hydrochloride |
| InChIKey | GZXXMEFWSWRREY-JBUOLDKXSA-N |
| SMILES | C1COC[C@@H]([C@@H]1N)O.Cl |
Computed by PubChem (NCBI)