CAS 1523530-38-2 appears in our catalog under these names: (3R,4R)-4-Aminooxan-3-ol hydrochloride, 95%, (3R,4R)-4-Aminotetrahydro-2H-pyran-3-ol hydrochloride, 95%, 95%, (3R,4R)-4-AMINOTETRAHYDRO-2H-PYRAN-3-OL HCL, 97%, (3R,4R)-4-Aminotetrahydro-2H-pyran-3-ol hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg, 25g, 100g.
(3R,4R)-4-aminooxan-3-ol;hydrochloride (CAS 1523530-38-2) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (3R,4R)-4-aminooxan-3-ol;hydrochloride. InChIKey: GZXXMEFWSWRREY-JBUOLDKXSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (3R,4R)-4-aminooxan-3-ol;hydrochloride |
| InChIKey | GZXXMEFWSWRREY-JBUOLDKXSA-N |
| SMILES | C1COC[C@@H]([C@@H]1N)O.Cl |
Computed by PubChem (NCBI)