cas: 1523530-25-7 — see every product listed under this CAS number, including other names
(3R,4R)-4-Fluoropyrrolidin-3-ol hydrochloride, 97%, 97% (CAS 1523530-25-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXYT-100mg |
| cas | 1523530-25-7 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 500mg | 285.20 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1490.00 Pln | |
| Chemat | 10g | 2483.60 Pln | |
| Chemat | 25g | 4907.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 1523530-25-7) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-VKKIDBQXSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)