CAS 1903830-44-3 appears in our catalog under these names: Trans-4-fluorotetrahydrofuran-3-amine hydrochloride, Trans-4-fluorotetrahydrofuran-3-amine hydrochloride, 95%, trans-4-Fluorotetrahydrofuran-3-amine hydrochloride, 97%, rel-(3R,4S)-4-Fluorotetrahydrofuran-3-amine hydrochloride, 97%, rel-(3R,4S)-4-Fluorotetrahydrofuran-3-amine hydrochloride 99%. Offered by: Biosynth, Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g, 250mg, 10g, 100mg.
(3S,4R)-4-fluorooxolan-3-amine;hydrochloride (CAS 1903830-44-3) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3S,4R)-4-fluorooxolan-3-amine;hydrochloride. InChIKey: ZDRLKYGLYRTMMM-MMALYQPHSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3S,4R)-4-fluorooxolan-3-amine;hydrochloride |
| InChIKey | ZDRLKYGLYRTMMM-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CO1)F)N.Cl |
Computed by PubChem (NCBI)